Name | Value |
---|---|
InChI=1S/C17H27NO6/c1-10(2)17(22,11(3)19)16(21)23-9-13-5-7-18-8-6-14(15(13)18)24-12(4)20/h5,10-11,14-15,19,22H,6-9H2,1-4H3/t11-,14+,15+,17-/m0/s1 | |
RKDOFSJTBIDAHX-OFSOMGBPSA-N | |
C17H27NO6 | |
341.183837584 | |
O=C(OC1CCN2CC=C(COC(=O)C(O)(C(O)C)C(C)C)C21)C |
External Identifier | Value |
---|---|
73544-48-6 | |
80703 | |
C16751 | |
156006 | |
137407 |
Name | Value |
---|---|
NA002363 | |
2020.02.21 | |
Tobias Schulze, Martin Krauss, Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
CC0 | |
Copyright (C) 2020 by Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
341.1838 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
30% (nominal) | |
15000 | |
Kinetex Evo C18 2.6 um 50 x 2.1 mm | |
95/5 at 0 min, 95/5 at 1 min, 0/100 at 13 min, 0/100 at 24 min, 95/5 at 24.3 min, 95/5/0 at 32 min | |
300 uL/min | |
2.531 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.14.1 | |
positive | |
1.1211951973340495 | |
0.6966377445641028 | |
342.1911 | |
[M+H]+ | |
2.0678036336919376 ppm | |
-7.075839999970412E-4 Da |