Name | Value |
---|---|
InChI=1S/C16H12O4/c1-19-12-5-2-10(3-6-12)14-9-20-15-8-11(17)4-7-13(15)16(14)18/h2-9,17H,1H3 | |
HKQYGTCOTHHOMP-UHFFFAOYSA-N | |
C16H12O4 | |
268.073558864 | |
O=C1C(=COC2=CC(O)=CC=C21)C=3C=CC(OC)=CC3 |
External Identifier | Value |
---|---|
485-72-3 | |
18088 | |
C00858 | |
LMPK12050037 | |
5280378 | |
4444070 |
Name | Value |
---|---|
NA002416 | |
2020.02.21 | |
Tobias Schulze, Martin Krauss, Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
CC0 | |
Copyright (C) 2020 by Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
268.0736 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
20% (nominal) | |
15000 | |
Kinetex Evo C18 2.6 um 50 x 2.1 mm | |
95/5 at 0 min, 95/5 at 1 min, 0/100 at 13 min, 0/100 at 24 min, 95/5 at 24.3 min, 95/5/0 at 32 min | |
300 uL/min | |
10.679 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.14.1 | |
positive | |
0.0 | |
NaN | |
269.0808 | |
[M+H]+ | |
2.7087179761454934 ppm | |
-7.288639999956104E-4 Da |