Name | Value |
---|---|
GYSCAQFHASJXRS-FFCOJMSVSA-N | |
InChI=1S/C45H57N3O9/c1-28(2)37-40(49)46(7)35(26-32-21-15-11-16-22-32)44(53)56-39(30(5)6)42(51)48(9)36(27-33-23-17-12-18-24-33)45(54)57-38(29(3)4)41(50)47(8)34(43(52)55-37)25-31-19-13-10-14-20-31/h10-24,28-30,34-39H,25-27H2,1-9H3/t34-,35-,36-,37+,38+,39+/m0/s1 | |
C45H57N3O9 | |
783.409480404 | |
O=C1OC(C(=O)N(C)C(C(=O)OC(C(=O)N(C)C(C(=O)OC(C(=O)N(C)C1CC=2C=CC=CC2)C(C)C)CC=3C=CC=CC3)C(C)C)CC=4C=CC=CC4)C(C)C |
External Identifier | Value |
---|---|
26048-05-5 | |
3000 | |
3007984 | |
2277520 |
Name | Value |
---|---|
NA002572 | |
2020.02.21 | |
CC0 | |
95/5 at 0 min, 95/5 at 1 min, 0/100 at 13 min, 0/100 at 24 min, 95/5 at 24.3 min, 95/5/0 at 32 min | |
300 uL/min | |
14.556 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.14.1 | |
positive | |
1.1977370052600387 | |
0.7441958437828716 | |
784.4168 | |
[M+H]+ | |
0.8291561322987492 ppm | |
-6.504039999981615E-4 Da | |
Tobias Schulze, Martin Krauss, Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
Copyright (C) 2020 by Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
783.4095 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
15% (nominal) | |
15000 | |
Kinetex Evo C18 2.6 um 50 x 2.1 mm |