Name | Value |
---|---|
InChI=1S/C21H33NO7/c1-7-13(2)18(23)29-16-9-11-22-10-8-15(17(16)22)12-28-19(24)21(26,14(3)27-6)20(4,5)25/h7-8,14,16-17,25-26H,9-12H2,1-6H3/b13-7-/t14-,16-,17+,21-/m0/s1 | |
QHOZSLCIKHUPSU-LPLKQDONSA-N | |
C21H33NO7 | |
411.225702396 | |
O=C(OC1CCN2CC=C(COC(=O)C(O)(C(OC)C)C(O)(C)C)C21)C(=CC)C |
External Identifier | Value |
---|---|
303-34-4 | |
5281735 | |
4445050 |
Name | Value |
---|---|
NA002695 | |
2020.02.21 | |
Tobias Schulze, Martin Krauss, Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
CC0 | |
Copyright (C) 2020 by Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
411.2257 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
50% (nominal) | |
15000 | |
Kinetex Evo C18 2.6 um 50 x 2.1 mm | |
95/5 at 0 min, 95/5 at 1 min, 0/100 at 13 min, 0/100 at 24 min, 95/5 at 24.3 min, 95/5/0 at 32 min | |
300 uL/min | |
7.434 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.14.1 | |
positive | |
1.2495110013399762 | |
0.36737385724122357 | |
412.233 | |
[M+H]+ | |
1.6311066798882587 ppm | |
-6.723959999703766E-4 Da |