Name | Value |
---|---|
InChI=1S/C15H24N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15-/m0/s1 | |
ZSBXGIUJOOQZMP-JLNYLFASSA-N | |
C15H24N2O | |
248.188863388 | |
O=C1N2CC3CCCN4CCCC(C2CCC1)C43 |
External Identifier | Value |
---|---|
519-02-8 | |
6700 | |
C10774 | |
91466 | |
82591 |
Name | Value |
---|---|
NA002728 | |
2020.02.21 | |
Tobias Schulze, Martin Krauss, Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
CC0 | |
Copyright (C) 2020 by Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
248.1889 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
55% (nominal) | |
15000 | |
Kinetex Evo C18 2.6 um 50 x 2.1 mm | |
95/5 at 0 min, 95/5 at 1 min, 0/100 at 13 min, 0/100 at 24 min, 95/5 at 24.3 min, 95/5/0 at 32 min | |
300 uL/min | |
0.712 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.14.1 | |
positive | |
0.2426423983847724 | |
0.17502949242955768 | |
249.1961 | |
[M+H]+ | |
2.9430155607821904 ppm | |
-7.333879999862347E-4 Da |