Name | Value |
---|---|
InChI=1S/C20H31NO7/c1-6-12(2)17(23)28-15-8-10-21-9-7-14(16(15)21)11-27-18(24)20(26,13(3)22)19(4,5)25/h6-7,13,15-16,22,25-26H,8-11H2,1-5H3/b12-6-/t13-,15+,16+,20-/m0/s1 | |
HRSGCYGUWHGOPY-LYHHMGRNSA-N | |
C20H31NO7 | |
397.210052332 | |
O=C(OC1CCN2CC=C(COC(=O)C(O)(C(O)C)C(O)(C)C)C21)C(=CC)C |
External Identifier | Value |
---|---|
520-68-3 | |
4744 | |
C10299 | |
5281729 | |
4445044 |
Name | Value |
---|---|
NA002859 | |
2020.02.21 | |
Tobias Schulze, Martin Krauss, Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
CC0 | |
Copyright (C) 2020 by Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
397.2101 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
35% (nominal) | |
15000 | |
Kinetex Evo C18 2.6 um 50 x 2.1 mm | |
95/5 at 0 min, 95/5 at 1 min, 0/100 at 13 min, 0/100 at 24 min, 95/5 at 24.3 min, 95/5/0 at 32 min | |
300 uL/min | |
6.481 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.14.1 | |
positive | |
1.3585588367389305 | |
0.44623052203708136 | |
398.2173 | |
[M+H]+ | |
1.8139141618220258 ppm | |
-7.223319999525302E-4 Da |