Name | Value |
---|---|
InChI=1S/C17H26O4/c1-3-4-5-6-14(18)12-15(19)9-7-13-8-10-16(20)17(11-13)21-2/h8,10-11,14,18,20H,3-7,9,12H2,1-2H3 | |
NLDDIKRKFXEWBK-UHFFFAOYSA-N | |
C17H26O4 | |
294.183109312 | |
O=C(CCC1=CC=C(O)C(OC)=C1)CC(O)CCCCC |
External Identifier | Value |
---|---|
1391-73-7 | |
3473 | |
3354 |
Name | Value |
---|---|
Peaks with additional N2/O included | |
RMassBank 2.14.1 | |
NA002995 | |
2020.02.21 | |
Tobias Schulze, Martin Krauss, Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
CC0 | |
Copyright (C) 2020 by Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
294.1831 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
40% (nominal) | |
15000 | |
Kinetex Evo C18 2.6 um 50 x 2.1 mm | |
95/5 at 0 min, 95/5 at 1 min, 0/100 at 13 min, 0/100 at 24 min, 95/5 at 24.3 min, 95/5/0 at 32 min | |
300 uL/min | |
11.616 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
positive | |
2.103406656370979 | |
0.9134979040604855 | |
295.1904 | |
[M+H]+ | |
2.3012672498441193 ppm | |
-6.793119999883857E-4 Da |