Name | Value |
---|---|
InChI=1S/C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H3,6,7,8,9,10) | |
GFFGJBXGBJISGV-UHFFFAOYSA-N | |
C5H5N5 | |
135.05449516000002 | |
N=1C=NC2=C(N=CNC12)N |
External Identifier | Value |
---|---|
73-24-5 | |
16708 | |
D00034 | |
190 | |
185 |
Name | Value |
---|---|
NA003008 | |
2020.02.21 | |
Tobias Schulze, Martin Krauss, Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
CC0 | |
Copyright (C) 2020 by Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
135.0545 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
45% (nominal) | |
15000 | |
Kinetex Evo C18 2.6 um 50 x 2.1 mm | |
95/5 at 0 min, 95/5 at 1 min, 0/100 at 13 min, 0/100 at 24 min, 95/5 at 24.3 min, 95/5/0 at 32 min | |
300 uL/min | |
0.698 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.14.1 | |
positive | |
0.041394165369577574 | |
0.05971915710042723 | |
136.0618 | |
[M+H]+ | |
4.888660888002038 ppm | |
-6.651600000111557E-4 Da |