Name | Value |
---|---|
InChI=1S/C15H25NO5/c1-9(2)15(20,10(3)17)14(19)21-8-11-4-6-16-7-5-12(18)13(11)16/h4,9-10,12-13,17-18,20H,5-8H2,1-3H3/t10-,12+,13+,15-/m0/s1 | |
SFVVQRJOGUKCEG-ZGFBFQLVSA-N | |
C15H25NO5 | |
299.1732729 | |
O=C(OCC1=CCN2CCC(O)C12)C(O)(C(O)C)C(C)C |
External Identifier | Value |
---|---|
10285-07-1 | |
6598 | |
C10347 | |
107938 | |
97061 |
Name | Value |
---|---|
NA003117 | |
2020.02.22 | |
Tobias Schulze, Martin Krauss, Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
CC0 | |
Copyright (C) 2020 by Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
299.1733 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
75% (nominal) | |
15000 | |
Kinetex Evo C18 2.6 um 50 x 2.1 mm | |
95/5 at 0 min, 95/5 at 1 min, 0/100 at 13 min, 0/100 at 24 min, 95/5 at 24.3 min, 95/5/0 at 32 min | |
300 uL/min | |
1.041 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.14.1 | |
positive | |
2.015338335896505 | |
0.7636584144196353 | |
300.1805 | |
[M+H]+ | |
2.4748443019365123 ppm | |
-7.428999999774533E-4 Da |