Name | Value |
---|---|
InChI=1S/C10H15NO/c1-11(2)8-7-9-3-5-10(12)6-4-9/h3-6,12H,7-8H2,1-2H3 | |
KUBCEEMXQZUPDQ-UHFFFAOYSA-N | |
C10H15NO | |
165.1153641 | |
OC1=CC=C(C=C1)CCN(C)C |
External Identifier | Value |
---|---|
539-15-1 | |
5764 | |
C06199 | |
68313 | |
61609 |
Name | Value |
---|---|
NA003545 | |
2020.02.22 | |
Tobias Schulze, Martin Krauss, Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
CC0 | |
Copyright (C) 2020 by Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
165.1154 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
90% (nominal) | |
15000 | |
Kinetex Evo C18 2.6 um 50 x 2.1 mm | |
95/5 at 0 min, 95/5 at 1 min, 0/100 at 13 min, 0/100 at 24 min, 95/5 at 24.3 min, 95/5/0 at 32 min | |
300 uL/min | |
0.547 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
positive | |
Peaks with additional N2/O included | |
RMassBank 2.14.1 | |
1.5345146049399463 | |
0.8564289076150731 | |
166.1226 | |
[M+H]+ | |
4.419025466663189 ppm | |
-7.340999999883024E-4 Da |