Name | Value |
---|---|
InChI=1S/C9H6O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H | |
ZYGHJZDHTFUPRJ-UHFFFAOYSA-N | |
C9H6O2 | |
146.036779432 | |
O=C1OC=2C=CC=CC2C=C1 |
External Identifier | Value |
---|---|
91-64-5 | |
28794 | |
D07751 | |
323 | |
13848793 |
Name | Value |
---|---|
NA003719 | |
2020.02.22 | |
Tobias Schulze, Martin Krauss, Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
CC0 | |
Copyright (C) 2020 by Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
146.0368 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
85% (nominal) | |
15000 | |
Kinetex Evo C18 2.6 um 50 x 2.1 mm | |
95/5 at 0 min, 95/5 at 1 min, 0/100 at 13 min, 0/100 at 24 min, 95/5 at 24.3 min, 95/5/0 at 32 min | |
300 uL/min | |
7.129 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.14.1 | |
positive | |
1.1820364147902584 | |
0.568439357922692 | |
147.0441 | |
[M+H]+ | |
4.416579788085437 ppm | |
-6.494320000172138E-4 Da |