Name | Value |
---|---|
InChI=1S/C9H6O3/c10-7-5-9(11)12-8-4-2-1-3-6(7)8/h1-5,11H | |
OWBBAPRUYLEWRR-UHFFFAOYSA-N | |
C9H6O3 | |
162.03169405199998 | |
O=C1C=C(O)OC=2C=CC=CC12 |
External Identifier | Value |
---|---|
1076-38-6 | |
14101 | |
13479 |
Name | Value |
---|---|
NA003725 | |
2020.02.22 | |
Tobias Schulze, Martin Krauss, Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
CC0 | |
Copyright (C) 2020 by Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
162.0317 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
90% (nominal) | |
15000 | |
Kinetex Evo C18 2.6 um 50 x 2.1 mm | |
95/5 at 0 min, 95/5 at 1 min, 0/100 at 13 min, 0/100 at 24 min, 95/5 at 24.3 min, 95/5/0 at 32 min | |
300 uL/min | |
8.040 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.14.1 | |
positive | |
1.7953761942004274 | |
0.6803096598368217 | |
163.039 | |
[M+H]+ | |
4.072964137356913 ppm | |
-6.640519999905337E-4 Da |