Name | Value |
---|---|
Natural Product; Bile acids | |
InChI=1S/C24H40O6/c1-12(4-7-21(29)30)14-5-6-15-22-16(10-20(28)24(14,15)3)23(2)11-19(27)17(25)8-13(23)9-18(22)26/h12-20,22,25-28H,4-11H2,1-3H3,(H,29,30)/t12-,13+,14-,15+,16+,17+,18-,19+,20+,22+,23+,24-/m1/s1 | |
IMMADCCLTPCOKH-HNWZYOJHSA-N | |
C24H40O6 | |
424.28248899999994 | |
O=C(O)CCC(C)C1CCC2C3C(O)CC4CC(O)C(O)CC4(C)C3CC(O)C12C |
External Identifier | Value |
---|---|
4446982 | |
BBA0115 | |
5283894 |
Name | Value |
---|---|
NU000398 | |
2016.01.19 (Created 2014.12.05) | |
Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
CC BY | |
Copyright (C) Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
424.28249 | |
JMS-T100LP, JEOL | |
LC-ESI-TOF | |
MS1 | |
250 C | |
1500 V | |
ESI | |
100-1000 | |
N2 | |
-2000 V | |
80 C | |
-90 V | |
-10 | |
negative | |
2.215953284803224 | |
0.6580809636829934 |