Name | Value |
---|---|
Natural Product; Bile acids | |
InChI=1S/C24H40O4/c1-14(4-9-21(26)27)16-7-8-17-15-5-6-19-22(28)20(25)11-13-24(19,3)18(15)10-12-23(16,17)2/h14-20,22,25,28H,4-13H2,1-3H3,(H,26,27)/t14-,15?,16?,17?,18?,19-,20+,22+,23-,24-/m1/s1 | |
LKUNZSUKADSCME-RMUKQWOFSA-N | |
C24H40O4 | |
392.29265976 | |
O=C(O)CCC(C)C1CCC2C3CCC4C(O)C(O)CCC4(C)C3CCC12C |
Name | Value |
---|---|
NU000409 | |
2016.01.19 (Created 2014.12.15) | |
Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
CC BY | |
Copyright (C) Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
392.29266 | |
JMS-T100LP, JEOL | |
LC-ESI-TOF | |
MS1 | |
250 C | |
1500 V | |
ESI | |
100-1000 | |
N2 | |
-2000 V | |
80 C | |
-120 V | |
-10 | |
negative | |
1.8910204539015978 | |
0.46977769874220376 |