Name | Value |
---|---|
Natural Product; Bile acid | |
InChI=1S/C24H40O6/c1-12(4-7-20(28)29)13-5-6-14-21-15(11-19(27)24(13,14)3)23(2)9-8-17(25)22(30)16(23)10-18(21)26/h12-19,21-22,25-27,30H,4-11H2,1-3H3,(H,28,29)/t12-,13-,14+,15+,16-,17+,18-,19+,21+,22-,23-,24-/m1/s1 | |
WGGZRKVUOFMQHM-VCELIZGUSA-N | |
C24H40O6 | |
424.28248899999994 | |
O=C(O)CCC(C)C1CCC2C3C(O)CC4C(O)C(O)CCC4(C)C3CC(O)C12C |
External Identifier | Value |
---|---|
4446984 | |
BBA0116 | |
5283896 |
Name | Value |
---|---|
NU000446 | |
2016.01.19 (Created 2015.02.03) | |
Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
CC BY | |
Copyright (C) Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
424.28249 | |
JMS-T100LP, JEOL | |
LC-ESI-TOF | |
MS1 | |
250 C | |
1500 V | |
ESI | |
100-1000 | |
N2 | |
-2000 V | |
80 C | |
-30 V | |
-10 | |
negative | |
4.18651173743612 | |
0.9110778116730727 |