Name | Value |
---|---|
Natural Product; Bile acid | |
InChI=1S/C24H40O6/c1-12(4-7-19(27)28)14-5-6-15-20-16(11-18(26)24(14,15)3)23(2)9-8-13(25)10-17(23)21(29)22(20)30/h12-18,20-22,25-26,29-30H,4-11H2,1-3H3,(H,27,28)/t12-,13-,14-,15+,16+,17+,18+,20+,21+,22+,23-,24-/m1/s1 | |
COCMFMBNEAMQMA-VGKGADPCSA-N | |
C24H40O6 | |
424.28248899999994 | |
O=C(O)CCC(C)C1CCC2C3C(O)C(O)C4CC(O)CCC4(C)C3CC(O)C12C |
External Identifier | Value |
---|---|
4446987 | |
BBA0120 | |
5283899 |
Name | Value |
---|---|
NU000548 | |
2016.01.15 | |
Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
CC BY | |
Copyright (C) Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
424.28249 | |
JMS-T100LP, JEOL | |
LC-ESI-TOF | |
MS1 | |
250 C | |
1500 V | |
ESI | |
100-1000 | |
N2 | |
-2000 V | |
80 C | |
-90 V | |
-10 | |
negative | |
2.7147587368789194 | |
0.6110672614495454 |