Name | Value |
---|---|
Natural Product; Bile acids | |
InChI=1S/C24H40O6/c1-12(4-7-19(27)28)14-5-6-15-20-16(11-18(26)24(14,15)3)23(2)9-8-13(25)10-17(23)21(29)22(20)30/h12-18,20-22,25-26,29-30H,4-11H2,1-3H3,(H,27,28)/t12-,13-,14-,15+,16+,17+,18+,20+,21+,22-,23-,24-/m1/s1 | |
COCMFMBNEAMQMA-KREOYVNCSA-N | |
C24H40O6 | |
424.28248899999994 | |
O=C(O)CCC(C)C1CCC2C3C(O)C(O)C4CC(O)CCC4(C)C3CC(O)C12C |
External Identifier | Value |
---|---|
4446988 | |
BBA0121 | |
5283900 |
Name | Value |
---|---|
NU000555 | |
2018.03.06 | |
Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
CC BY | |
Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
424.28249 | |
JMS-T100LP, JEOL | |
LC-ESI-TOF | |
MS1 | |
ESI | |
80 C | |
-150 V | |
100-1000 | |
negative | |
2.515196331983219 | |
0.7719833659412075 |