Name | Value |
---|---|
Natural Product; Bile acids | |
InChI=1S/C24H40O3/c1-15(7-10-22(26)27)17-8-9-18-16-14-21(25)20-6-4-5-12-23(20,2)19(16)11-13-24(17,18)3/h15-21,25H,4-14H2,1-3H3,(H,26,27)/t15-,16+,17-,18+,19+,20-,21-,23-,24-/m1/s1 | |
AOZMFMMOEOBOTA-YULDWDGFSA-N | |
C24H40O3 | |
376.29774513999996 | |
O=C(O)CCC(C)C1CCC2C3CC(O)C4CCCCC4(C)C3CCC12C |
External Identifier | Value |
---|---|
4446895 | |
BBA0010 | |
5283807 |
Name | Value |
---|---|
NU000568 | |
2018.02.20 | |
Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
CC BY | |
Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
376.29775 | |
JMS-T100LP, JEOL | |
LC-ESI-TOF | |
MS1 | |
ESI | |
80 C | |
-90 V | |
100-1000 | |
negative | |
1.7217777619214862 | |
0.6712716400862918 |