Name | Value |
---|---|
Natural Product; Bile acids | |
InChI=1S/C24H40O4/c1-14(4-7-22(27)28)17-5-6-18-16-13-21(26)20-12-15(25)8-10-24(20,3)19(16)9-11-23(17,18)2/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15+,16+,17-,18+,19+,20-,21-,23-,24-/m1/s1 | |
DGABKXLVXPYZII-VDMUPYQOSA-N | |
C24H40O4 | |
392.29265976 | |
O=C(O)CCC(C)C1CCC2C3CC(O)C4CC(O)CCC4(C)C3CCC12C |
External Identifier | Value |
---|---|
197482 | |
BBA0031 | |
227030 |
Name | Value |
---|---|
2018.02.20 | |
NU000586 | |
Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
CC BY | |
Takashi Iida, Department of Chemistry, College of Humanities and Sciences, Nihon University | |
392.29266 | |
JMS-T100LP, JEOL | |
LC-ESI-TOF | |
MS1 | |
ESI | |
80 C | |
-30 V | |
100-1000 | |
negative | |
1.9687076677946305 | |
0.8959974724938545 |