Name | Value |
---|---|
Carboxylic acids | |
InChI=1S/C7H7NO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,8H2,(H,9,10) | |
RWZYAGGXGHYGMB-UHFFFAOYSA-N | |
C7H7NO2 | |
137.047678464 | |
O=C(O)C=1C=CC=CC1N |
External Identifier | Value |
---|---|
118-92-3 | |
222 | |
C00108 | |
C00007382 | |
227 |
Name | Value |
---|---|
PR100023 | |
2016.01.19 (Created 2009.09.10, modified 2011.05.06) | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
137.04768 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
400 C | |
LOW-ENERGY CID | |
ESI | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
positive | |
0.8632912511042482 | |
0.6227330034054639 | |
138.05548 | |
[M+H]+ | |
1.2202630421634568 ppm | |
-1.6846400001213624E-4 Da |