Name | Value |
---|---|
Flavonoid | |
InChI=1S/C21H22O11/c22-7-16-18(27)19(28)20(29)21(32-16)30-9-4-12(25)17-13(26)6-14(31-15(17)5-9)8-1-2-10(23)11(24)3-8/h1-5,14,16,18-25,27-29H,6-7H2/t14-,16+,18+,19-,20+,21+/m0/s1 | |
RAFHNDRXYHOLSH-SFTVRKLSSA-N | |
C21H22O11 | |
450.116211524 | |
O=C1C2=C(O)C=C(OC3OC(CO)C(O)C(O)C3O)C=C2OC(C4=CC=C(O)C(O)=C4)C1 |
External Identifier | Value |
---|---|
38965-51-4 | |
16740887 | |
C00008291 | |
5319853 |
Name | Value |
---|---|
PR100239 | |
2016.01.19 (Created 2009.09.10, modified 2011.05.06) | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
450.11621 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
400 C | |
LOW-ENERGY CID | |
ESI | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
positive | |
1.4605825212506054 | |
0.7023917200724492 | |
451.12401 | |
[M+H]+ | |
0.3802147440463555 ppm | |
-1.7152399999531553E-4 Da |