Name | Value |
---|---|
Flavonoid | |
InChI=1S/C21H20O11/c22-6-14-17(27)19(29)20(30)21(32-14)16-11(26)5-13-15(18(16)28)10(25)4-12(31-13)7-1-2-8(23)9(24)3-7/h1-5,14,17,19-24,26-30H,6H2/t14-,17-,19+,20-,21+/m1/s1 | |
ODBRNZZJSYPIDI-VJXVFPJBSA-N | |
C21H20O11 | |
448.10056146 | |
O=C1C=C(OC2=CC(O)=C(C(O)=C12)C3OC(CO)C(O)C(O)C3O)C=4C=CC(O)=C(O)C4 |
External Identifier | Value |
---|---|
4261-42-1 | |
102753 | |
C01821 | |
C00001055 | |
114776 |
Name | Value |
---|---|
PR100246 | |
2016.01.19 (Created 2009.09.10, modified 2011.05.06) | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
448.10056 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
400 C | |
LOW-ENERGY CID | |
ESI | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
positive | |
2.1886862124038413 | |
0.9127530452360498 | |
449.10836 | |
[M+H]+ | |
0.38177868697438666 ppm | |
-1.7145999999002015E-4 Da |