Name | Value |
---|---|
Flavonoid | |
InChI=1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15-,17+,18-,21+/m1/s1 | |
OVSQVDMCBVZWGM-QSOFNFLRSA-N | |
C21H20O12 | |
464.09547607999997 | |
O=C1C(OC2OC(CO)C(O)C(O)C2O)=C(OC=3C=C(O)C=C(O)C13)C=4C=CC(O)=C(O)C4 |
External Identifier | Value |
---|---|
482-35-9 | |
4444361 | |
C05623 | |
C00005373 | |
5280804 |
Name | Value |
---|---|
PR100254 | |
2016.01.19 (Created 2009.09.10, modified 2011.05.06) | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
464.09548 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
400 C | |
LOW-ENERGY CID | |
ESI | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
positive | |
1.4334073559528717 | |
0.4959249107098307 | |
465.10327 | |
[M+H]+ | |
0.3785825886800707 ppm | |
-1.7607999996016588E-4 Da |