Name | Value |
---|---|
Flavonoid | |
InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15-/m0/s1 | |
PFTAWBLQPZVEMU-ZFWWWQNUSA-N | |
C15H14O6 | |
290.07903816799995 | |
OC=1C=C(O)C2=C(OC(C3=CC=C(O)C(O)=C3)C(O)C2)C1 |
External Identifier | Value |
---|---|
35323-91-2 | |
158494 | |
C09728 | |
C00000957 | |
182232 |
Name | Value |
---|---|
PR100263 | |
2016.01.19 (Created 2009.09.10, modified 2011.05.06) | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
290.07904 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
400 C | |
LOW-ENERGY CID | |
ESI | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
positive | |
1.43629240537143 | |
0.8016100542726469 | |
291.08683 | |
[M+H]+ | |
0.6120785331784876 ppm | |
-1.781679999339758E-4 Da |