Name | Value |
---|---|
Nucleotide-(amino alcohol) | |
InChI=1S/C14H26N4O11P2/c1-18(2,3)6-7-26-30(22,23)29-31(24,25)27-8-9-11(19)12(20)13(28-9)17-5-4-10(15)16-14(17)21/h4-5,9,11-13,19-20H,6-8H2,1-3H3,(H3-,15,16,21,22,23,24,25)/t9-,11-,12-,13-/m1/s1 | |
RZZPDXZPRHQOCG-OJAKKHQRSA-N | |
C14H26N4O11P2 | |
488.10733091199995 | |
O=P([O-])(OCC1OC(N2C=CC(=N)N=C2O)C(O)C1O)OP(=O)(O)OCC[N+](C)(C)C |
External Identifier | Value |
---|---|
987-78-0 | |
13207 | |
C00307 | |
C00007231 | |
13804 |
Name | Value |
---|---|
PR100317 | |
2016.01.19 (Created 2009.09.10, modified 2011.05.06) | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
488.10733 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
400 C | |
LOW-ENERGY CID | |
ESI | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
C14H27N4O11P2 | |
488.32 | |
positive | |
1.7572666218093942 | |
0.8450666136013716 | |
489.11513 | |
[M+H]+ | |
0.3494310223657722 ppm | |
-1.7091199993046757E-4 Da |