Name | Value |
---|---|
Carboxylic acids | |
InChI=1S/C4H9NO2/c1-3(5)2-4(6)7/h3H,2,5H2,1H3,(H,6,7) | |
OQEBBZSWEGYTPG-UHFFFAOYSA-N | |
C4H9NO2 | |
103.063328528 | |
O=C(O)CC(N)C |
External Identifier | Value |
---|---|
541-48-0 | |
2042235 | |
2761506 |
Name | Value |
---|---|
PR100331 | |
2016.01.19 (Created 2009.09.10, modified 2011.05.06) | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
103.06333 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
400 C | |
LOW-ENERGY CID | |
ESI | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
positive | |
0.27078686285251463 | |
0.39066286417520274 | |
104.07113 | |
[M+H]+ | |
1.6193539937850274 ppm | |
-1.6852800000322077E-4 Da |