Name | Value |
---|---|
Nucleoside | |
InChI=1S/C15H22N6O5S/c1-27(3-2-7(16)15(24)25)4-8-10(22)11(23)14(26-8)21-6-20-9-12(17)18-5-19-13(9)21/h5-8,10-11,14,22-23H,2-4,16H2,1H3,(H2-,17,18,19,24,25)/t7-,8+,10+,11+,14+,27?/m0/s1 | |
MEFKEPWMEQBLKI-AIRLBKTGSA-N | |
C15H22N6O5S | |
398.137238804 | |
O=C([O-])C(N)CC[S+](C)CC1OC(N2C=NC=3C(=NC=NC32)N)C(O)C1O |
External Identifier | Value |
---|---|
29908-03-0 | |
31982 | |
C00019 | |
C00007347 | |
34755 |
Name | Value |
---|---|
PR100378 | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
398.13724 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
420 C | |
LOW-ENERGY CID | |
ESI | |
1.0 sec/scan (m/z = 50-1000) | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH) / H2O(0.1%HCOOH) | |
positive | |
1.6317864171158378 | |
0.9107173396543352 | |
399.14503 | |
[M+H]+ | |
0.4479674968579411 ppm | |
-1.7880399997238783E-4 Da |