Name | Value |
---|---|
Purines | |
InChI=1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)11(2)7(13)9-5/h3H,1-2H3,(H,9,13) | |
QUNWUDVFRNGTCO-UHFFFAOYSA-N | |
C7H8N4O2 | |
180.064725496 | |
O=C1C2=C(N=CN2C)N=C(O)N1C |
External Identifier | Value |
---|---|
611-59-6 | |
4525 | |
C13747 | |
4687 |
Name | Value |
---|---|
PR100414 | |
2016.01.19 (Created 2009.09.10, modified 2011.05.06) | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
180.06473 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
400 C | |
LOW-ENERGY CID | |
ESI | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
positive | |
1.1879793012571545 | |
0.5406726802125015 | |
181.07252 | |
[M+H]+ | |
0.9692028365050126 ppm | |
-1.7549599999711063E-4 Da |