Name | Value |
---|---|
Carboxylic acids | |
InChI=1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3+ | |
KSEBMYQBYZTDHS-HWKANZROSA-N | |
C10H10O4 | |
194.0579088 | |
O=C(O)C=CC1=CC=C(O)C(OC)=C1 |
External Identifier | Value |
---|---|
1135-24-6 | |
393368 | |
C01494 | |
C00002743 | |
445858 |
Name | Value |
---|---|
PR100482 | |
2016.01.19 (Created 2010.06.21, modified 2012.10.22) | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
194.05791 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
400 C | |
LOW-ENERGY CID | |
ESI | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
negative | |
1.1114737290292425 | |
0.8017588184744259 | |
193.05011 | |
[M-H]- | |
2.708105165167976 ppm | |
-5.228000000272459E-4 Da |