Name | Value |
---|---|
Natural Product; Nucleoside; Phosphates | |
InChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1 | |
UDMBCSSLTHHNCD-KQYNXXCUSA-N | |
C10H14N5O7P | |
347.063084418 | |
O=P(O)(O)OCC1OC(N2C=NC=3C(=NC=NC32)N)C(O)C1O |
External Identifier | Value |
---|---|
61-19-8 | |
5858 | |
C00020 | |
C00019347 | |
6083 |
Name | Value |
---|---|
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
PR100515 | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
347.06308 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
420 C | |
LOW-ENERGY CID | |
ESI | |
1.0 sec/scan (m/z = 50-1000) | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH) / H2O(0.1%HCOOH) | |
negative | |
1.2780600048529647 | |
0.9219254154799483 | |
346.05528 | |
[M-H]- | |
1.5269756902551506 ppm | |
-5.284180000444394E-4 Da |