Name | Value |
---|---|
Flavonoid | |
InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15+/m0/s1 | |
PFTAWBLQPZVEMU-DZGCQCFKSA-N | |
C15H14O6 | |
290.07903816799995 | |
OC=1C=C(O)C2=C(OC(C3=CC=C(O)C(O)=C3)C(O)C2)C1 |
External Identifier | Value |
---|---|
154-23-4 | |
8711 | |
C06562 | |
C00000947 | |
9064 |
Name | Value |
---|---|
PR100687 | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
290.07904 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
420 C | |
LOW-ENERGY CID | |
ESI | |
1.0 sec/scan (m/z = 50-1000) | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH) / H2O(0.1%HCOOH) | |
negative | |
2.357079599766783 | |
0.8931521014401061 | |
289.07123 | |
[M-H]- | |
1.8409580225251279 ppm | |
-5.321679999497064E-4 Da |