Name | Value |
---|---|
Natural Product; Nucleoside; Phosphates | |
InChI=1S/C10H14N5O7P/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(22-6)2-21-23(18,19)20/h3-6,16H,1-2H2,(H2,18,19,20)(H3,11,13,14,17)/t4-,5+,6+/m0/s1 | |
LTFMZDNNPPEQNG-KVQBGUIXSA-N | |
C10H14N5O7P | |
347.063084418 | |
O=P(O)(O)OCC1OC(N2C=NC=3C(O)=NC(=N)NC32)CC1O |
External Identifier | Value |
---|---|
902-04-5 | |
58570 | |
C00362 | |
C00019356 | |
65059 |
Name | Value |
---|---|
1.292385164541901 | |
PR100696 | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
347.06308 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
420 C | |
LOW-ENERGY CID | |
ESI | |
1.0 sec/scan (m/z = 50-1000) | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH) / H2O(0.1%HCOOH) | |
negative | |
0.8030040516364553 | |
346.05528 | |
[M-H]- | |
1.5269756902551506 ppm | |
-5.284180000444394E-4 Da |