Name | Value |
---|---|
Flavonoid | |
InChI=1S/C27H30O15/c1-9-17(31)20(34)23(37)26(38-9)42-25-21(35)18(32)15(8-28)41-27(25)39-12-6-13(30)16-14(7-12)40-24(22(36)19(16)33)10-2-4-11(29)5-3-10/h2-7,9,15,17-18,20-21,23,25-32,34-37H,8H2,1H3/t9-,15+,17-,18+,20+,21-,23+,25+,26-,27+/m0/s1 | |
ZEJXENDZTYVXDP-CSJHBIPPSA-N | |
C27H30O15 | |
594.15847026 | |
O=C1C(O)=C(OC2=CC(OC3OC(CO)C(O)C(O)C3OC4OC(C)C(O)C(O)C4O)=CC(O)=C12)C=5C=CC(O)=CC5 |
External Identifier | Value |
---|---|
17353-03-6 | |
4588328 | |
C00005197 | |
5483905 |
Name | Value |
---|---|
LC-ESI-QTOF | |
MS2 | |
PR100802 | |
2016.01.19 (Created 2010.06.21, modified 2011.05.06) | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
594.15847 | |
UPLC Q-Tof Premier, Waters | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
400 C | |
LOW-ENERGY CID | |
ESI | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
negative | |
0.8706362451951359 | |
0.792487262499714 | |
593.15066 | |
[M-H]- | |
0.9007155111000209 ppm | |
-5.342599998812148E-4 Da |