Name | Value |
---|---|
Flavonoid | |
InChI=1S/C20H18O10/c21-9-3-1-8(2-4-9)18-19(30-20-17(27)15(25)12(24)7-28-20)16(26)14-11(23)5-10(22)6-13(14)29-18/h1-6,12,15,17,20-25,27H,7H2/t12-,15+,17-,20+/m1/s1 | |
RNVUDWOQYYWXBJ-BWYUNELBSA-N | |
C20H18O10 | |
418.089996776 | |
O=C1C(OC2OCC(O)C(O)C2O)=C(OC=3C=C(O)C=C(O)C13)C=4C=CC(O)=CC4 |
External Identifier | Value |
---|---|
99882-10-7 | |
4587618 | |
C00005133 | |
5481882 |
Name | Value |
---|---|
PR101021 | |
2016.01.19 (Created 2009.09.10, modified 2011.05.06) | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
418.09 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
400 C | |
LOW-ENERGY CID | |
ESI | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
positive | |
1.01785980161479 | |
0.4244805072020248 | |
419.09781 | |
[M+H]+ | |
0.37407974057374965 ppm | |
-1.567760000398266E-4 Da |