Name | Value |
---|---|
Flavonoid | |
InChI=1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1 | |
JPUKWEQWGBDDQB-QSOFNFLRSA-N | |
C21H20O11 | |
448.10056146 | |
O=C1C(OC2OC(CO)C(O)C(O)C2O)=C(OC=3C=C(O)C=C(O)C13)C=4C=CC(O)=CC4 |
External Identifier | Value |
---|---|
480-10-4 | |
4445311 | |
C12249 | |
C00005138 | |
5282102 |
Name | Value |
---|---|
PR101025 | |
2016.01.19 (Created 2009.09.10, modified 2011.05.06) | |
Matsuda F, Suzuki M, Sawada Y, Plant Science Center, RIKEN. | |
CC BY-SA | |
Acquisition and generation of the data is financially supported in part by CREST/JST. | |
448.10056 | |
UPLC Q-Tof Premier, Waters | |
LC-ESI-QTOF | |
MS2 | |
Ramp 5-60 V | |
Continuum | |
600.0 L/Hr | |
400 C | |
LOW-ENERGY CID | |
ESI | |
120 C | |
3.0 kV | |
23.0 V | |
CH3CN(0.1%HCOOH)/ H2O(0.1%HCOOH) | |
positive | |
1.2435267529239475 | |
0.4848153236657403 | |
449.10838 | |
[M+H]+ | |
0.3372459894506352 ppm | |
-1.5145999998367188E-4 Da |