Name | Value |
---|---|
InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1 | |
OVBPIULPVIDEAO-LBPRGKRZSA-N | |
C19H19N7O6 | |
441.139681328 | |
O=C(O)CCC(NC(=O)C1=CC=C(C=C1)NCC2=NC=3C(O)=NC(=N)NC3N=C2)C(=O)O |
Name | Value |
---|---|
2017.10.22 | |
RP013402 | |
BGC, Helmholtz Zentrum Muenchen | |
CC BY | |
Copyright (C) 2017 | |
441.139681 | |
maXis plus UHR-ToF-MS, Bruker Daltonics | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
CID | |
20 | |
BEH C18 1.7um, 2.1x100mm, Waters | |
95/5 at 0 min, 95/5 at 1.12 min, 0.5/99.5 at 6.41 min, 0.5/99.5 at 10.01 min | |
400 uL/min | |
2.478 min | |
Water with 0.1% formic acid | |
ACN with 0.1% formic acid | |
Peaks with additional N2/O included | |
RMassBank 2.4.0 | |
positive | |
0.7127504384214806 | |
0.27007766387757504 | |
442.147 | |
[M+H]+ | |
1.4731028368473817 ppm | |
-6.513280000035593E-4 Da |