Name | Value |
---|---|
Natural Product; Curvularin | |
InChI=1S/C16H18O5/c1-10-5-3-2-4-6-13(18)16-11(8-15(20)21-10)7-12(17)9-14(16)19/h4,6-7,9-10,17,19H,2-3,5,8H2,1H3/b6-4+/t10-/m0/s1 | |
AVIRMQMUBGNCKS-RWCYGVJQSA-N | |
C16H18O5 | |
290.115423676 | |
O=C1C=CCCCC(OC(=O)CC=2C=C(O)C=C(O)C12)C |
External Identifier | Value |
---|---|
4942635 | |
6438143 |
Name | Value |
---|---|
TT000153 | |
2016.01.19 (Created 2008.10.21, modified 2011.05.06) | |
Kimura Y, Kusano M, Faculty of Agriculture, Tottori University | |
CC BY-SA | |
Kusano, M., Nakagami, K., Fujioka, S., Kawano, T., Shimada, A., and Kimura, Y. 2003. beta,gamma-Dehydrocurvularin and Related Compounds as Nematicides of Pratylenchus penetrans from the Fungus Aspergillus sp. Biosci. Biotechnol. Biochem., 67 (6):1413 -1416. | |
[Analytical] Sample was directly injected | |
290.11542 | |
Unknown | |
EI-B | |
MS1 | |
70 eV | |
positive | |
3.807915063562138 | |
0.6947940042800964 |