Name | Value |
---|---|
C18H31NO4 | |
InChI=1S/C18H31NO4/c1-14(2)19-11-17(20)13-23-18-7-5-16(6-8-18)12-21-9-10-22-15(3)4/h5-8,14-15,17,19-20H,9-13H2,1-4H3 | |
VHYCDWMUTMEGQY-UHFFFAOYSA-N | |
325.225308472 | |
OC(COC1=CC=C(C=C1)COCCOC(C)C)CNC(C)C |
External Identifier | Value |
---|---|
2312 | |
2405 |
Name | Value |
---|---|
TUE00192 | |
2015.11.27 | |
Lege S, Zwiener C, Environmental Analytical Chemistry (EAC), University of Tuebingen | |
CC BY | |
Copyright (C) 2015, Environmental Analytical Chemistry (EAC), University of Tuebingen, Germany | |
CONFIDENCE Reference Standard (Level 1) | |
325.22531 | |
6550 Q-TOF (Agilent Technologies) | |
LC-ESI-QTOF | |
MS2 | |
20.0V | |
12000 (m/z 120) - 26000 (m/z 1000) | |
Flow injection | |
AcN:H2O (50:50) + 0.1 % Acetic acid + 1mM Ammoniumacetate | |
positive | |
1.844108236071889 | |
0.6508892949910159 | |
326.23259 | |
[M+H]+ | |
2.1103716216056196 ppm | |
-6.884719999789013E-4 Da |