Name | Value |
---|---|
InChI=1S/C9H17NO2/c10-7-9(6-8(11)12)4-2-1-3-5-9/h1-7,10H2,(H,11,12) | |
UGJMXCAKCUNAIE-UHFFFAOYSA-N | |
C9H17NO2 | |
171.125928784 | |
O=C(O)CC1(CN)CCCCC1 |
External Identifier | Value |
---|---|
3328 | |
3446 |
Name | Value |
---|---|
TUE00342 | |
2015.11.27 | |
Lege S, Zwiener C, Environmental Analytical Chemistry (EAC), University of Tuebingen | |
CC BY | |
Copyright (C) 2015, Environmental Analytical Chemistry (EAC), University of Tuebingen, Germany | |
CONFIDENCE Reference Standard (Level 1) | |
171.12593 | |
6550 Q-TOF (Agilent Technologies) | |
LC-ESI-QTOF | |
MS2 | |
20.0V | |
12000 (m/z 120) - 26000 (m/z 1000) | |
Flow injection | |
AcN:H2O (50:50) + 0.1 % Acetic acid + 1mM Ammoniumacetate | |
positive | |
2.4052355974477755 | |
0.7297799300254008 | |
172.13321 | |
[M+H]+ | |
4.001459102544572 ppm | |
-6.887840000047163E-4 Da |