Name | Value |
---|---|
InChI=1S/C15H25NO3/c1-12(2)16-10-14(17)11-19-15-6-4-13(5-7-15)8-9-18-3/h4-7,12,14,16-17H,8-11H2,1-3H3 | |
IUBSYMUCCVWXPE-UHFFFAOYSA-N | |
C15H25NO3 | |
267.18344365999997 | |
OC(COC1=CC=C(C=C1)CCOC)CNC(C)C |
External Identifier | Value |
---|---|
4027 | |
4171 |
Name | Value |
---|---|
TUE00533 | |
2015.11.27 | |
Lege S, Zwiener C, Environmental Analytical Chemistry (EAC), University of Tuebingen | |
CC BY | |
Copyright (C) 2015, Environmental Analytical Chemistry (EAC), University of Tuebingen, Germany | |
CONFIDENCE Reference Standard (Level 1) | |
267.18344 | |
6550 Q-TOF (Agilent Technologies) | |
LC-ESI-QTOF | |
MS2 | |
40.0V | |
12000 (m/z 120) - 26000 (m/z 1000) | |
Flow injection | |
AcN:H2O (50:50) + 0.1 % Acetic acid + 1mM Ammoniumacetate | |
positive | |
2.9925491252122782 | |
0.8287502506588074 | |
268.19072 | |
[M+H]+ | |
2.586442961067489 ppm | |
-6.936599999676218E-4 Da |