Name | Value |
---|---|
InChI=1S/C17H27NO2/c1-18(2)13-16(17(19)11-5-4-6-12-17)14-7-9-15(20-3)10-8-14/h7-10,16,19H,4-6,11-13H2,1-3H3 | |
PNVNVHUZROJLTJ-UHFFFAOYSA-N | |
C17H27NO2 | |
277.204179104 | |
OC1(CCCCC1)C(C2=CC=C(OC)C=C2)CN(C)C |
External Identifier | Value |
---|---|
5454 | |
5656 |
Name | Value |
---|---|
2015.11.27 | |
TUE00812 | |
Lege S, Zwiener C, Environmental Analytical Chemistry (EAC), University of Tuebingen | |
CC BY | |
Copyright (C) 2015, Environmental Analytical Chemistry (EAC), University of Tuebingen, Germany | |
CONFIDENCE Reference Standard (Level 1) | |
277.20418 | |
6550 Q-TOF (Agilent Technologies) | |
LC-ESI-QTOF | |
MS2 | |
20.0V | |
12000 (m/z 120) - 26000 (m/z 1000) | |
Flow injection | |
AcN:H2O (50:50) + 0.1 % Acetic acid + 1mM Ammoniumacetate | |
positive | |
0.8535498891533224 | |
0.43863787316577685 | |
278.21146 | |
[M+H]+ | |
2.4769073136051674 ppm | |
-6.891040000027715E-4 Da |