Name | Value |
---|---|
InChI=1S/C6H5N3/c1-2-4-6-5(3-1)7-9-8-6/h1-4H,(H,7,8,9) | |
QRUDEWIWKLJBPS-UHFFFAOYSA-N | |
C6H5N3 | |
119.04834715999999 | |
N1=NC=2C=CC=CC2N1 |
External Identifier | Value |
---|---|
95-14-7 | |
7220 | |
6950 |
Name | Value |
---|---|
UA000201 | |
2014.06.24 | |
C. Gallampois (Umea), E. Schymanski (Eawag), W. Brack (UFZ) | |
CC BY | |
Copyright (C) Eawag, 2014 | |
Multi-criteria approach for tentative identification of polyaromatic river mutagens | |
119.0483 | |
LTQ Orbitrap XL Thermo Scientific | |
ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 % (nominal) | |
30000 | |
N/A | |
Direct infusion experiment | |
5 uL/min | |
N/A min | |
methanol | |
N/A | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.5.2.3 | |
positive | |
0.1322266461046966 | |
0.19076272660862575 | |
120.0556 | |
[M+H]+ | |
5.973565581226992 ppm | |
-7.171599999935552E-4 Da |