Name | Value |
---|---|
InChI=1S/C13H9N/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13/h1-9H | |
RDOWQLZANAYVLL-UHFFFAOYSA-N | |
C13H9N | |
179.073499288 | |
N1=CC2=CC=CC=C2C3=CC=CC=C13 |
External Identifier | Value |
---|---|
229-87-8 | |
9189 | |
8834 |
Name | Value |
---|---|
UA000401 | |
2014.06.24 | |
C. Gallampois (Umea), E. Schymanski (Eawag), W. Brack (UFZ) | |
CC BY | |
Copyright (C) Eawag, 2014 | |
Multi-criteria approach for tentative identification of polyaromatic river mutagens | |
179.0735 | |
LTQ Orbitrap XL Thermo Scientific | |
ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 % (nominal) | |
30000 | |
N/A | |
Direct infusion experiment | |
5 uL/min | |
N/A min | |
methanol | |
N/A | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.5.2.3 | |
positive | |
0.012171955803553246 | |
0.017560420275705906 | |
180.0808 | |
[M+H]+ | |
3.7165983268800766 ppm | |
-6.692879999832257E-4 Da |