Name | Value |
---|---|
InChI=1S/C11H10N4/c1-15-9-5-4-8-7(3-2-6-13-8)10(9)14-11(15)12/h2-6H,1H3,(H2,12,14) | |
ARZWATDYIYAUTA-UHFFFAOYSA-N | |
C11H10N4 | |
198.09054632 | |
N=C1NC=2C3=CC=CN=C3C=CC2N1C |
External Identifier | Value |
---|---|
76180-96-6 | |
C19180 | |
53462 | |
48285 |
Name | Value |
---|---|
UA000502 | |
2014.06.24 | |
C. Gallampois (Umea), E. Schymanski (Eawag), W. Brack (UFZ) | |
CC BY | |
Copyright (C) Eawag, 2014 | |
Multi-criteria approach for tentative identification of polyaromatic river mutagens | |
198.0905 | |
LTQ Orbitrap XL Thermo Scientific | |
ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 % (nominal) | |
30000 | |
N/A | |
Direct infusion experiment | |
5 uL/min | |
N/A min | |
methanol | |
N/A | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.5.2.3 | |
negative | |
0.5300863537029602 | |
0.7647529537301737 | |
197.0833 | |
[M-H]- | |
0.1505962200321752 ppm | |
2.96800000114672E-5 Da |