Name | Value |
---|---|
InChI=1S/C12H10N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-7,14H,1H3 | |
PSFDQSOCUJVVGF-UHFFFAOYSA-N | |
C12H10N2 | |
182.08439832 | |
N=1C=CC=2C=3C=CC=CC3NC2C1C |
External Identifier | Value |
---|---|
486-84-0 | |
C09209 | |
5281404 | |
4444755 |
Name | Value |
---|---|
UA000701 | |
2014.06.24 | |
C. Gallampois (Umea), E. Schymanski (Eawag), W. Brack (UFZ) | |
CC BY | |
Copyright (C) Eawag, 2014 | |
Multi-criteria approach for tentative identification of polyaromatic river mutagens | |
182.0844 | |
LTQ Orbitrap XL Thermo Scientific | |
ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 % (nominal) | |
30000 | |
N/A | |
Direct infusion experiment | |
5 uL/min | |
N/A min | |
methanol | |
N/A | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.5.2.3 | |
positive | |
0.0899060380378252 | |
0.05017751522003089 | |
183.0917 | |
[M+H]+ | |
3.650192772192285 ppm | |
-6.683199999883982E-4 Da |