Name | Value |
---|---|
InChI=1S/C11H9N3/c12-10-6-5-8-7-3-1-2-4-9(7)13-11(8)14-10/h1-6H,(H3,12,13,14) | |
FJTNLJLPLJDTRM-UHFFFAOYSA-N | |
C11H9N3 | |
183.079647288 | |
N=C1C=CC=2C=3C=CC=CC3NC2N1 |
External Identifier | Value |
---|---|
26148-68-5 | |
C19186 | |
62805 | |
56541 |
Name | Value |
---|---|
UA000801 | |
2014.06.24 | |
C. Gallampois (Umea), E. Schymanski (Eawag), W. Brack (UFZ) | |
CC BY | |
Copyright (C) Eawag, 2014 | |
Multi-criteria approach for tentative identification of polyaromatic river mutagens | |
183.0796 | |
LTQ Orbitrap XL Thermo Scientific | |
ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 % (nominal) | |
30000 | |
N/A | |
Direct infusion experiment | |
5 uL/min | |
N/A min | |
methanol | |
N/A | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.5.2.3 | |
positive | |
0.6681360079018691 | |
0.6081636031141399 | |
184.0869 | |
[M+H]+ | |
3.896464115457016 ppm | |
-7.172879999757242E-4 Da |