Name | Value |
---|---|
InChI=1S/C10H6O2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6H | |
FRASJONUBLZVQX-UHFFFAOYSA-N | |
C10H6O2 | |
158.036779432 | |
O=C1C=CC(=O)C=2C=CC=CC12 |
External Identifier | Value |
---|---|
130-15-4 | |
C02617 | |
8530 | |
8215 |
Name | Value |
---|---|
UA001805 | |
2014.06.24 | |
C. Gallampois (Umea), E. Schymanski (Eawag), W. Brack (UFZ) | |
CC BY | |
Copyright (C) Eawag, 2014 | |
Multi-criteria approach for tentative identification of polyaromatic river mutagens | |
158.0368 | |
LTQ Orbitrap XL Thermo Scientific | |
APCI-ITFT | |
MS2 | |
APCI | |
CID | |
35 % (nominal) | |
30000 | |
N/A | |
Direct infusion experiment | |
5 uL/min | |
N/A min | |
methanol | |
N/A | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.5.2.3 | |
negative | |
0.12845242117481884 | |
0.1853176710190916 | |
158.0373 | |
[M]- |