Name | Value |
---|---|
InChI=1S/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3 | |
RYYVLZVUVIJVGH-UHFFFAOYSA-N | |
C8H10N4O2 | |
194.08037556 | |
O=C1C2=C(N=CN2C)N(C(=O)N1C)C |
External Identifier | Value |
---|---|
58-08-2 | |
D00528 | |
2519 | |
2424 |
Name | Value |
---|---|
UA005001 | |
2014.06.24 | |
C. Gallampois (Umea), E. Schymanski (Eawag), W. Brack (UFZ) | |
CC BY | |
Copyright (C) Eawag, 2014 | |
Multi-criteria approach for tentative identification of polyaromatic river mutagens | |
194.0804 | |
LTQ Orbitrap XL Thermo Scientific | |
ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 % (nominal) | |
30000 | |
N/A | |
Direct infusion experiment | |
5 uL/min | |
N/A min | |
methanol | |
N/A | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.5.2.3 | |
positive | |
0.6087740739065554 | |
0.29275844581558624 | |
195.0877 | |
[M+H]+ | |
3.309075866807903 ppm | |
-6.455599999810602E-4 Da |