Name | Value |
---|---|
InChI=1S/C10H13ClN2O/c1-7-4-5-8(6-9(7)11)12-10(14)13(2)3/h4-6H,1-3H3,(H,12,14) | |
JXCGFZXSOMJFOA-UHFFFAOYSA-N | |
C10H13ClN2O | |
212.071640716 | |
ClC1=CC(N=C(O)N(C)C)=CC=C1C |
External Identifier | Value |
---|---|
15545-48-9 | |
81981 | |
C18817 | |
27375 | |
25472 |
Name | Value |
---|---|
UF400702 | |
2017.01.05 | |
CC BY | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
Copyright (C) 2017 | |
212.0716 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
80 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
22.946 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
0.6126250346592793 | |
0.38064533581960325 | |
213.0789 | |
[M+H]+ | |
3.3354593063235156 ppm | |
-7.107159999861778E-4 Da |