Name | Value |
---|---|
InChI=1S/C7H7N3/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H3,8,9,10) | |
JWYUFVNJZUSCSM-UHFFFAOYSA-N | |
C7H7N3 | |
133.063997224 | |
N=C1NC=2C=CC=CC2N1 |
External Identifier | Value |
---|---|
934-32-7 | |
27822 | |
C10901 | |
13624 | |
13035 |
Name | Value |
---|---|
UF400801 | |
2017.01.05 | |
Schulze T, Krauss M, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research - UFZ GmbH, Leipzig, Germany | |
CC BY | |
Copyright (C) 2017 | |
133.064 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
55 (nominal) | |
15000 | |
Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex | |
90/10 at 0 min, 80/20 at 3.2 min, 5/95 at 17.8 min, 5/95 at 37.8 min, 90/10 at 37.9 min, 90/10 at 47 min | |
200 uL/min | |
8.044 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.2.1 | |
positive | |
0.030434550409472835 | |
0.04390777494743163 | |
134.0713 | |
[M+H]+ | |
4.976635566172476 ppm | |
-6.672239999829799E-4 Da |